C26H30N4O5 — CID 44962872
[2-[4-[2-[(5-oxo-1-phenylpyrrolidine-3-carbonyl)amino]ethyl]piperazine-1-carbonyl]phenyl] acetate (PubChem CID 44962872) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is [2-[4-[2-[(5-oxo-1-phenylpyrrolidine-3-carbonyl)amino]ethyl]piperazine-1-carbonyl]phenyl] acetate.
| Compound Name | [2-[4-[2-[(5-oxo-1-phenylpyrrolidine-3-carbonyl)amino]ethyl]piperazine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 44962872 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | [2-[4-[2-[(5-oxo-1-phenylpyrrolidine-3-carbonyl)amino]ethyl]piperazine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)N1CCN(CCNC(=O)C2CC(=O)N(c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C26H30N4O5/c1-19(31)35-23-10-6-5-9-22(23)26(34)29-15-13-28(14-16-29)12-11-27-25(33)20-17-24(32)30(18-20)21-7-3-2-4-8-21/h2-10,20H,11-18H2,1H3,(H,27,33) |
| InChIKey | JJYNXCGOCMKSEM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|