C40H56O9Si — CID 44968060
[(3aS,4R,5S,6R,7R,7aR)-5,6-di(butanoyloxy)-7-[tert-butyl(diphenyl)silyl]oxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] butanoate (PubChem CID 44968060) has the molecular formula C40H56O9Si and a molecular weight of 708.97 g/mol. Its IUPAC name is [(3aS,4R,5S,6R,7R,7aR)-5,6-di(butanoyloxy)-7-[tert-butyl(diphenyl)silyl]oxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] butanoate.
| Compound Name | [(3aS,4R,5S,6R,7R,7aR)-5,6-di(butanoyloxy)-7-[tert-butyl(diphenyl)silyl]oxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] butanoate |
|---|---|
| PubChem CID | 44968060 |
| Molecular Formula | C40H56O9Si |
| Molecular Weight | 708.97 g/mol |
| Exact Mass | 708.37 |
| IUPAC Name | [(3aS,4R,5S,6R,7R,7aR)-5,6-di(butanoyloxy)-7-[tert-butyl(diphenyl)silyl]oxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1[C@@H](OC(=O)CCC)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C40H56O9Si/c1-7-19-30(41)44-33-34(45-31(42)20-8-2)36-37(48-40(47-36)26-17-12-18-27-40)38(35(33)46-32(43)21-9-3)49-50(39(4,5)6,28-22-13-10-14-23-28)29-24-15-11-16-25-29/h10-11,13-16,22-25,33-38H,7-9,12,17-21,26-27H2,1-6H3/t33-,34-,35+,36+,37+,38-/m0/s1 |
| InChIKey | AWKLDSWITYCJRK-RXTQGPJUSA-N |
| XLogP | 6.53 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.97 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|