C20H17N3O3S — CID 44968199
ethyl 5-[4-(thiophen-2-ylmethylamino)quinazolin-6-yl]furan-2-carboxylate (PubChem CID 44968199) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is ethyl 5-[4-(thiophen-2-ylmethylamino)quinazolin-6-yl]furan-2-carboxylate.
| Compound Name | ethyl 5-[4-(thiophen-2-ylmethylamino)quinazolin-6-yl]furan-2-carboxylate |
|---|---|
| PubChem CID | 44968199 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | ethyl 5-[4-(thiophen-2-ylmethylamino)quinazolin-6-yl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(-c2ccc3ncnc(NCc4cccs4)c3c2)o1 |
| InChI | InChI=1S/C20H17N3O3S/c1-2-25-20(24)18-8-7-17(26-18)13-5-6-16-15(10-13)19(23-12-22-16)21-11-14-4-3-9-27-14/h3-10,12H,2,11H2,1H3,(H,21,22,23) |
| InChIKey | KRJRCFXYZBUBRL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |