About [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol
[5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol (PubChem CID 44968229) has the molecular formula C18H16N4O2S
and a molecular weight of 352.42 g/mol. Its IUPAC name is [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol |
| PubChem CID | 44968229 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol |
| SMILES | Cc1nc(CNc2ncnc3ccc(-c4ccc(CO)o4)cc23)cs1 |
| InChI | InChI=1S/C18H16N4O2S/c1-11-22-13(9-25-11)7-19-18-15-6-12(2-4-16(15)20-10-21-18)17-5-3-14(8-23)24-17/h2-6,9-10,23H,7-8H2,1H3,(H,19,20,21) |
| InChIKey | BEBHQWLIHVJACK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol?
The IUPAC name of [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol (CID 44968229) is [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol.
What is the SMILES notation for [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol?
The canonical SMILES for [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol is Cc1nc(CNc2ncnc3ccc(-c4ccc(CO)o4)cc23)cs1.
What is the InChIKey of [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol?
The InChIKey is BEBHQWLIHVJACK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O2S/c1-11-22-13(9-25-11)7-19-18-15-6-12(2-4-16(15)20-10-21-18)17-5-3-14(8-23)24-17/h2-6,9-10,23H,7-8H2,1H3,(H,19,20,21).
What are the key properties of [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol?
[5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol has a molecular weight of 352.42 g/mol, XLogP of 3.76, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-yl]methanol is sourced from PubChem (CID 44968229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).