About ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate
ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate (PubChem CID 44968259) has the molecular formula C20H18N4O3S
and a molecular weight of 394.46 g/mol. Its IUPAC name is ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate |
| PubChem CID | 44968259 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(-c2ccc3ncnc(NCc4csc(C)n4)c3c2)o1 |
| InChI | InChI=1S/C20H18N4O3S/c1-3-26-20(25)18-7-6-17(27-18)13-4-5-16-15(8-13)19(23-11-22-16)21-9-14-10-28-12(2)24-14/h4-8,10-11H,3,9H2,1-2H3,(H,21,22,23) |
| InChIKey | LAMPWKNHJWKCSD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate?
The IUPAC name of ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate (CID 44968259) is ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate.
What is the SMILES notation for ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate?
The canonical SMILES for ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate is CCOC(=O)c1ccc(-c2ccc3ncnc(NCc4csc(C)n4)c3c2)o1.
What is the InChIKey of ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate?
The InChIKey is LAMPWKNHJWKCSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O3S/c1-3-26-20(25)18-7-6-17(27-18)13-4-5-16-15(8-13)19(23-11-22-16)21-9-14-10-28-12(2)24-14/h4-8,10-11H,3,9H2,1-2H3,(H,21,22,23).
What are the key properties of ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate?
ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate has a molecular weight of 394.46 g/mol, XLogP of 4.44, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[4-[(2-methyl-1,3-thiazol-4-yl)methylamino]quinazolin-6-yl]furan-2-carboxylate is sourced from PubChem (CID 44968259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).