C21H28FN5O3S — CID 44969561
N-cyclopentyl-2-[[7-(2-fluorophenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide (PubChem CID 44969561) has the molecular formula C21H28FN5O3S and a molecular weight of 449.55 g/mol. Its IUPAC name is N-cyclopentyl-2-[[7-(2-fluorophenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide.
| Compound Name | N-cyclopentyl-2-[[7-(2-fluorophenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 44969561 |
| Molecular Formula | C21H28FN5O3S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-cyclopentyl-2-[[7-(2-fluorophenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide |
| SMILES | CN1C(=O)C2C(SCC(=O)NC3CCCC3)NC(c3ccccc3F)NC2N(C)C1=O |
| InChI | InChI=1S/C21H28FN5O3S/c1-26-18-16(20(29)27(2)21(26)30)19(31-11-15(28)23-12-7-3-4-8-12)25-17(24-18)13-9-5-6-10-14(13)22/h5-6,9-10,12,16-19,24-25H,3-4,7-8,11H2,1-2H3,(H,23,28) |
| InChIKey | XCRLRFKZONFASE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |