About N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide
N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide (PubChem CID 45000132) has the molecular formula C11H22N4O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide.
Molecular Properties
| Compound Name | N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide |
| PubChem CID | 45000132 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide |
| SMILES | CN1CCN(NC(=O)C(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C11H22N4O2/c1-11(2,3)12-9(16)10(17)13-15-7-5-14(4)6-8-15/h5-8H2,1-4H3,(H,12,16)(H,13,17) |
| InChIKey | VEDGXIJPUYWMIL-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide?
The IUPAC name of N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide (CID 45000132) is N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide.
What is the SMILES notation for N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide?
The canonical SMILES for N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide is CN1CCN(NC(=O)C(=O)NC(C)(C)C)CC1.
What is the InChIKey of N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide?
The InChIKey is VEDGXIJPUYWMIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4O2/c1-11(2,3)12-9(16)10(17)13-15-7-5-14(4)6-8-15/h5-8H2,1-4H3,(H,12,16)(H,13,17).
What are the key properties of N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide?
N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide has a molecular weight of 242.32 g/mol, XLogP of -0.82, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-(4-methylpiperazin-1-yl)oxamide is sourced from PubChem (CID 45000132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).