C22H17BrN2O4 — CID 4500113
4-[[2-(2-benzoyl-4-bromoanilino)acetyl]amino]benzoic acid (PubChem CID 4500113) has the molecular formula C22H17BrN2O4 and a molecular weight of 453.29 g/mol. Its IUPAC name is 4-[[2-(2-benzoyl-4-bromoanilino)acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-(2-benzoyl-4-bromoanilino)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 4500113 |
| Molecular Formula | C22H17BrN2O4 |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 4-[[2-(2-benzoyl-4-bromoanilino)acetyl]amino]benzoic acid |
| SMILES | O=C(CNc1ccc(Br)cc1C(=O)c1ccccc1)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H17BrN2O4/c23-16-8-11-19(18(12-16)21(27)14-4-2-1-3-5-14)24-13-20(26)25-17-9-6-15(7-10-17)22(28)29/h1-12,24H,13H2,(H,25,26)(H,28,29) |
| InChIKey | WKCLKJKYGMUMJB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|