C19H22F2N2O2 — CID 45001628
N-[2-(dimethylamino)-2-(4-ethoxyphenyl)ethyl]-3,4-difluorobenzamide (PubChem CID 45001628) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-ethoxyphenyl)ethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-ethoxyphenyl)ethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 45001628 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-ethoxyphenyl)ethyl]-3,4-difluorobenzamide |
| SMILES | CCOc1ccc(C(CNC(=O)c2ccc(F)c(F)c2)N(C)C)cc1 |
| InChI | InChI=1S/C19H22F2N2O2/c1-4-25-15-8-5-13(6-9-15)18(23(2)3)12-22-19(24)14-7-10-16(20)17(21)11-14/h5-11,18H,4,12H2,1-3H3,(H,22,24) |
| InChIKey | VPEVGANWGOZKHZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |