About N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide
N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide (PubChem CID 4500205) has the molecular formula C26H28N6O4
and a molecular weight of 488.55 g/mol. Its IUPAC name is N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide.
Molecular Properties
| Compound Name | N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide |
| PubChem CID | 4500205 |
| Molecular Formula | C26H28N6O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide |
| SMILES | Cc1ccc2c(c1)c(/N=N/C(=O)CCCCC(=O)/N=N/c1c(O)n(C)c3ccc(C)cc13)c(O)n2C |
| InChI | InChI=1S/C26H28N6O4/c1-15-9-11-19-17(13-15)23(25(35)31(19)3)29-27-21(33)7-5-6-8-22(34)28-30-24-18-14-16(2)10-12-20(18)32(4)26(24)36/h9-14,35-36H,5-8H2,1-4H3/b29-27+,30-28+ |
| InChIKey | PANRGYTZBDEYCE-QAVVBOBSSA-N |
| XLogP | 6.18 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide?
The IUPAC name of N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide (CID 4500205) is N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide.
What is the SMILES notation for N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide?
The canonical SMILES for N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide is Cc1ccc2c(c1)c(/N=N/C(=O)CCCCC(=O)/N=N/c1c(O)n(C)c3ccc(C)cc13)c(O)n2C.
What is the InChIKey of N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide?
The InChIKey is PANRGYTZBDEYCE-QAVVBOBSSA-N. The full InChI is InChI=1S/C26H28N6O4/c1-15-9-11-19-17(13-15)23(25(35)31(19)3)29-27-21(33)7-5-6-8-22(34)28-30-24-18-14-16(2)10-12-20(18)32(4)26(24)36/h9-14,35-36H,5-8H2,1-4H3/b29-27+,30-28+.
What are the key properties of N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide?
N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide has a molecular weight of 488.55 g/mol, XLogP of 6.18, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis[(2-hydroxy-1,5-dimethylindol-3-yl)imino]hexanediamide is sourced from PubChem (CID 4500205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).