About 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide
2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide (PubChem CID 4500586) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide |
| PubChem CID | 4500586 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide |
| SMILES | CNC(=O)CN1C(=O)CC2(CCCC2)CC1=O |
| InChI | InChI=1S/C12H18N2O3/c1-13-9(15)8-14-10(16)6-12(7-11(14)17)4-2-3-5-12/h2-8H2,1H3,(H,13,15) |
| InChIKey | MLFPDQHCMVEWRE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide?
The IUPAC name of 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide (CID 4500586) is 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide.
What is the SMILES notation for 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide?
The canonical SMILES for 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide is CNC(=O)CN1C(=O)CC2(CCCC2)CC1=O.
What is the InChIKey of 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide?
The InChIKey is MLFPDQHCMVEWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-13-9(15)8-14-10(16)6-12(7-11(14)17)4-2-3-5-12/h2-8H2,1H3,(H,13,15).
What are the key properties of 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide?
2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide has a molecular weight of 238.29 g/mol, XLogP of 0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)-N-methylacetamide is sourced from PubChem (CID 4500586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).