C20H17N5O2S — CID 45009804
2-[[5-(1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-3-ylacetamide (PubChem CID 45009804) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is 2-[[5-(1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[5-(1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 45009804 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-[[5-(1-benzofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-3-ylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccnc2)nnc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H17N5O2S/c1-2-10-25-19(17-11-14-6-3-4-8-16(14)27-17)23-24-20(25)28-13-18(26)22-15-7-5-9-21-12-15/h2-9,11-12H,1,10,13H2,(H,22,26) |
| InChIKey | YVLMKGXMTKNRQQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|