C22H28N2O — CID 45013570
1-benzyl-N-(2,4,6-trimethylphenyl)piperidine-4-carboxamide (PubChem CID 45013570) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-benzyl-N-(2,4,6-trimethylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-benzyl-N-(2,4,6-trimethylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45013570 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-benzyl-N-(2,4,6-trimethylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2CCN(Cc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H28N2O/c1-16-13-17(2)21(18(3)14-16)23-22(25)20-9-11-24(12-10-20)15-19-7-5-4-6-8-19/h4-8,13-14,20H,9-12,15H2,1-3H3,(H,23,25) |
| InChIKey | CTALIWTXFZJLGO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |