C19H19BrN4O4S — CID 4501964
N-[[(4-anilino-4-oxobutanoyl)amino]carbamothioyl]-3-bromo-4-methoxybenzamide (PubChem CID 4501964) has the molecular formula C19H19BrN4O4S and a molecular weight of 479.36 g/mol. Its IUPAC name is N-[[(4-anilino-4-oxobutanoyl)amino]carbamothioyl]-3-bromo-4-methoxybenzamide.
| Compound Name | N-[[(4-anilino-4-oxobutanoyl)amino]carbamothioyl]-3-bromo-4-methoxybenzamide |
|---|---|
| PubChem CID | 4501964 |
| Molecular Formula | C19H19BrN4O4S |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | N-[[(4-anilino-4-oxobutanoyl)amino]carbamothioyl]-3-bromo-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)NNC(=O)CCC(=O)Nc2ccccc2)cc1Br |
| InChI | InChI=1S/C19H19BrN4O4S/c1-28-15-8-7-12(11-14(15)20)18(27)22-19(29)24-23-17(26)10-9-16(25)21-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,21,25)(H,23,26)(H2,22,24,27,29) |
| InChIKey | FWIFOZMGWLEWBE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|