C18H22N4O2 — CID 4502261
5-[2-[(2-butoxyphenyl)methylidene]hydrazinyl]-2-propan-2-yl-1,3-oxazole-4-carbonitrile (PubChem CID 4502261) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-[2-[(2-butoxyphenyl)methylidene]hydrazinyl]-2-propan-2-yl-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[2-[(2-butoxyphenyl)methylidene]hydrazinyl]-2-propan-2-yl-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 4502261 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-[2-[(2-butoxyphenyl)methylidene]hydrazinyl]-2-propan-2-yl-1,3-oxazole-4-carbonitrile |
| SMILES | CCCCOc1ccccc1C=NNc1oc(C(C)C)nc1C#N |
| InChI | InChI=1S/C18H22N4O2/c1-4-5-10-23-16-9-7-6-8-14(16)12-20-22-18-15(11-19)21-17(24-18)13(2)3/h6-9,12-13,22H,4-5,10H2,1-3H3 |
| InChIKey | GDQWHTCGMDHEOT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|