C8H12N4O2S — CID 45023590
3,7-dimethyl-8-methylsulfanyl-4,5-dihydropurine-2,6-dione (PubChem CID 45023590) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is 3,7-dimethyl-8-methylsulfanyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-methylsulfanyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 45023590 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3,7-dimethyl-8-methylsulfanyl-4,5-dihydropurine-2,6-dione |
| SMILES | CSC1=NC2C(C(=O)NC(=O)N2C)N1C |
| InChI | InChI=1S/C8H12N4O2S/c1-11-4-5(9-8(11)15-3)12(2)7(14)10-6(4)13/h4-5H,1-3H3,(H,10,13,14) |
| InChIKey | FYWLHPLHMNJPOT-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |