C9H12N2O — CID 45024465
3-amino-5,6,7,8-tetrahydro-3H-quinolin-2-one (PubChem CID 45024465) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-amino-5,6,7,8-tetrahydro-3H-quinolin-2-one.
| Compound Name | 3-amino-5,6,7,8-tetrahydro-3H-quinolin-2-one |
|---|---|
| PubChem CID | 45024465 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3-amino-5,6,7,8-tetrahydro-3H-quinolin-2-one |
| SMILES | NC1C=C2CCCCC2=NC1=O |
| InChI | InChI=1S/C9H12N2O/c10-7-5-6-3-1-2-4-8(6)11-9(7)12/h5,7H,1-4,10H2 |
| InChIKey | OZQRTKAXACTLGA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |