C41H34N6O8 — CID 45027891
8-nitro-6-[3-[3-[3-(3-nitro-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propylamino]propylamino]propyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 45027891) has the molecular formula C41H34N6O8 and a molecular weight of 738.76 g/mol. Its IUPAC name is 8-nitro-6-[3-[3-[3-(3-nitro-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propylamino]propylamino]propyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 8-nitro-6-[3-[3-[3-(3-nitro-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propylamino]propylamino]propyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 45027891 |
| Molecular Formula | C41H34N6O8 |
| Molecular Weight | 738.76 g/mol |
| Exact Mass | 738.24 |
| IUPAC Name | 8-nitro-6-[3-[3-[3-(3-nitro-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)propylamino]propylamino]propyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2-c2c1c1ccccc1c(=O)n2CCCNCCCNCCCn1c2c(c3ccc([N+](=O)[O-])cc3c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C41H34N6O8/c48-38-29-10-3-2-9-28(29)36-35(38)27-14-12-25(47(54)55)23-33(27)41(51)44(36)20-6-18-42-16-5-17-43-19-7-21-45-37-32-22-24(46(52)53)13-15-30(32)39(49)34(37)26-8-1-4-11-31(26)40(45)50/h1-4,8-15,22-23,42-43H,5-7,16-21H2 |
| InChIKey | AHPZKMKWGRCHRS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 188.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.76 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|