C32H30O2S — CID 45027912
[(1S,2S,11S,14S)-7-methoxy-14-methyl-19-thiahexacyclo[12.10.0.02,11.05,10.015,23.016,20]tetracosa-5(10),6,8,15,17,20,22-heptaen-21-yl]-phenylmethanone (PubChem CID 45027912) has the molecular formula C32H30O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is [(1S,2S,11S,14S)-7-methoxy-14-methyl-19-thiahexacyclo[12.10.0.02,11.05,10.015,23.016,20]tetracosa-5(10),6,8,15,17,20,22-heptaen-21-yl]-phenylmethanone.
| Compound Name | [(1S,2S,11S,14S)-7-methoxy-14-methyl-19-thiahexacyclo[12.10.0.02,11.05,10.015,23.016,20]tetracosa-5(10),6,8,15,17,20,22-heptaen-21-yl]-phenylmethanone |
|---|---|
| PubChem CID | 45027912 |
| Molecular Formula | C32H30O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [(1S,2S,11S,14S)-7-methoxy-14-methyl-19-thiahexacyclo[12.10.0.02,11.05,10.015,23.016,20]tetracosa-5(10),6,8,15,17,20,22-heptaen-21-yl]-phenylmethanone |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)c3c(cc(C(=O)c4ccccc4)c4sccc34)C[C@@H]12 |
| InChI | InChI=1S/C32H30O2S/c1-32-14-12-24-23-11-9-22(34-2)16-20(23)8-10-25(24)28(32)18-21-17-27(30(33)19-6-4-3-5-7-19)31-26(29(21)32)13-15-35-31/h3-7,9,11,13,15-17,24-25,28H,8,10,12,14,18H2,1-2H3/t24-,25-,28+,32+/m1/s1 |
| InChIKey | YWCDVNWRGWUQAX-QKFVYFNMSA-N |
| XLogP | 7.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |