About 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine
1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine (PubChem CID 45028134) has the molecular formula C16H14N4O2
and a molecular weight of 294.31 g/mol. Its IUPAC name is 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine.
Molecular Properties
| Compound Name | 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine |
| PubChem CID | 45028134 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine |
| SMILES | c1ccc2c(c1)COC(NNC1=Nc3ccccc3CO1)=N2 |
| InChI | InChI=1S/C16H14N4O2/c1-3-7-13-11(5-1)9-21-15(17-13)19-20-16-18-14-8-4-2-6-12(14)10-22-16/h1-8H,9-10H2,(H,17,19)(H,18,20) |
| InChIKey | WLFLDGLRPSLTQE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine?
The IUPAC name of 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine (CID 45028134) is 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine.
What is the SMILES notation for 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine?
The canonical SMILES for 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine is c1ccc2c(c1)COC(NNC1=Nc3ccccc3CO1)=N2.
What is the InChIKey of 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine?
The InChIKey is WLFLDGLRPSLTQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O2/c1-3-7-13-11(5-1)9-21-15(17-13)19-20-16-18-14-8-4-2-6-12(14)10-22-16/h1-8H,9-10H2,(H,17,19)(H,18,20).
What are the key properties of 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine?
1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine has a molecular weight of 294.31 g/mol, XLogP of 2.52, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(4H-3,1-benzoxazin-2-yl)hydrazine is sourced from PubChem (CID 45028134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).