C23H23FN4O3S2 — CID 45028141
N-[1-[(2Z)-2-[(5E)-5-[(2-fluorophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 45028141) has the molecular formula C23H23FN4O3S2 and a molecular weight of 486.59 g/mol. Its IUPAC name is N-[1-[(2Z)-2-[(5E)-5-[(2-fluorophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[1-[(2Z)-2-[(5E)-5-[(2-fluorophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 45028141 |
| Molecular Formula | C23H23FN4O3S2 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-[1-[(2Z)-2-[(5E)-5-[(2-fluorophenyl)methylidene]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccccc1)C(=O)N/N=C1\S/C(=C/c2ccccc2F)C(=O)N1C |
| InChI | InChI=1S/C23H23FN4O3S2/c1-28-22(31)19(14-16-10-6-7-11-17(16)24)33-23(28)27-26-21(30)18(12-13-32-2)25-20(29)15-8-4-3-5-9-15/h3-11,14,18H,12-13H2,1-2H3,(H,25,29)(H,26,30)/b19-14+,27-23- |
| InChIKey | FPZIVAPSBQQPOB-VDSHRRNKSA-N |
| XLogP | 3.31 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|