C25H25FN4O3S2 — CID 45028142
N-[1-[(2Z)-2-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 45028142) has the molecular formula C25H25FN4O3S2 and a molecular weight of 512.63 g/mol. Its IUPAC name is N-[1-[(2Z)-2-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[1-[(2Z)-2-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 45028142 |
| Molecular Formula | C25H25FN4O3S2 |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | N-[1-[(2Z)-2-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc(F)cc2)S/C1=N\NC(=O)C(CCSC)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H25FN4O3S2/c1-3-14-30-24(33)21(16-17-9-11-19(26)12-10-17)35-25(30)29-28-23(32)20(13-15-34-2)27-22(31)18-7-5-4-6-8-18/h3-12,16,20H,1,13-15H2,2H3,(H,27,31)(H,28,32)/b21-16+,29-25- |
| InChIKey | LYIUXEXPSQSMKY-JVYJKNHESA-N |
| XLogP | 3.87 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|