C38H28N4O8S2 — CID 45028276
methyl 6-[bis-(4-methylphenyl)sulfonylamino]-7-methoxy-12-oxo-3,13,23-triazahexacyclo[11.10.1.02,11.04,9.014,19.020,24]tetracosa-1(24),2(11),3,5,7,9,14,16,18,20,22-undecaene-22-carboxylate (PubChem CID 45028276) has the molecular formula C38H28N4O8S2 and a molecular weight of 732.80 g/mol. Its IUPAC name is methyl 6-[bis-(4-methylphenyl)sulfonylamino]-7-methoxy-12-oxo-3,13,23-triazahexacyclo[11.10.1.02,11.04,9.014,19.020,24]tetracosa-1(24),2(11),3,5,7,9,14,16,18,20,22-undecaene-22-carboxylate.
| Compound Name | methyl 6-[bis-(4-methylphenyl)sulfonylamino]-7-methoxy-12-oxo-3,13,23-triazahexacyclo[11.10.1.02,11.04,9.014,19.020,24]tetracosa-1(24),2(11),3,5,7,9,14,16,18,20,22-undecaene-22-carboxylate |
|---|---|
| PubChem CID | 45028276 |
| Molecular Formula | C38H28N4O8S2 |
| Molecular Weight | 732.80 g/mol |
| Exact Mass | 732.13 |
| IUPAC Name | methyl 6-[bis-(4-methylphenyl)sulfonylamino]-7-methoxy-12-oxo-3,13,23-triazahexacyclo[11.10.1.02,11.04,9.014,19.020,24]tetracosa-1(24),2(11),3,5,7,9,14,16,18,20,22-undecaene-22-carboxylate |
| SMILES | COC(=O)c1cc2c3ccccc3n3c(=O)c4cc5cc(OC)c(N(S(=O)(=O)c6ccc(C)cc6)S(=O)(=O)c6ccc(C)cc6)cc5nc4c(n1)c23 |
| InChI | InChI=1S/C38H28N4O8S2/c1-21-9-13-24(14-10-21)51(45,46)42(52(47,48)25-15-11-22(2)12-16-25)32-20-29-23(18-33(32)49-3)17-28-34(39-29)35-36-27(19-30(40-35)38(44)50-4)26-7-5-6-8-31(26)41(36)37(28)43/h5-20H,1-4H3 |
| InChIKey | BVLBWHFVIQTRFE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 154.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.80 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|