C16H13N5O3 — CID 45028352
2'-amino-4',4'-dimethoxy-2-oxospiro[1H-indole-3,6'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 45028352) has the molecular formula C16H13N5O3 and a molecular weight of 323.31 g/mol. Its IUPAC name is 2'-amino-4',4'-dimethoxy-2-oxospiro[1H-indole-3,6'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | 2'-amino-4',4'-dimethoxy-2-oxospiro[1H-indole-3,6'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 45028352 |
| Molecular Formula | C16H13N5O3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2'-amino-4',4'-dimethoxy-2-oxospiro[1H-indole-3,6'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | COC1(OC)N=C(N)C2(C#N)C3(C(=O)Nc4ccccc43)C12C#N |
| InChI | InChI=1S/C16H13N5O3/c1-23-16(24-2)14(8-18)13(7-17,11(19)21-16)15(14)9-5-3-4-6-10(9)20-12(15)22/h3-6H,1-2H3,(H2,19,21)(H,20,22) |
| InChIKey | WAOKYVVRYUFHJS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|