C30H29N3O4S — CID 45028353
(6aS)-3-[4-[4-(1,3-benzothiazol-2-yl)phenoxy]butoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 45028353) has the molecular formula C30H29N3O4S and a molecular weight of 527.65 g/mol. Its IUPAC name is (6aS)-3-[4-[4-(1,3-benzothiazol-2-yl)phenoxy]butoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-3-[4-[4-(1,3-benzothiazol-2-yl)phenoxy]butoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 45028353 |
| Molecular Formula | C30H29N3O4S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | (6aS)-3-[4-[4-(1,3-benzothiazol-2-yl)phenoxy]butoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc2c(cc1OCCCCOc1ccc(-c3nc4ccccc4s3)cc1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C30H29N3O4S/c1-35-26-17-23-25(31-19-21-7-6-14-33(21)30(23)34)18-27(26)37-16-5-4-15-36-22-12-10-20(11-13-22)29-32-24-8-2-3-9-28(24)38-29/h2-3,8-13,17-19,21H,4-7,14-16H2,1H3/t21-/m0/s1 |
| InChIKey | HIEUCCMEZNTHRS-NRFANRHFSA-N |
| XLogP | 6.53 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|