C31H31N3O5S — CID 45028354
(6aS)-3-[4-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 45028354) has the molecular formula C31H31N3O5S and a molecular weight of 557.67 g/mol. Its IUPAC name is (6aS)-3-[4-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-3-[4-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 45028354 |
| Molecular Formula | C31H31N3O5S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | (6aS)-3-[4-[4-(1,3-benzothiazol-2-yl)-2-methoxyphenoxy]butoxy]-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc(-c2nc3ccccc3s2)ccc1OCCCCOc1cc2c(cc1OC)C(=O)N1CCC[C@H]1C=N2 |
| InChI | InChI=1S/C31H31N3O5S/c1-36-26-16-20(30-33-23-9-3-4-10-29(23)40-30)11-12-25(26)38-14-5-6-15-39-28-18-24-22(17-27(28)37-2)31(35)34-13-7-8-21(34)19-32-24/h3-4,9-12,16-19,21H,5-8,13-15H2,1-2H3/t21-/m0/s1 |
| InChIKey | HLLYDTKPUVTXKU-NRFANRHFSA-N |
| XLogP | 6.54 |
| TPSA | 82.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|