About dibenzo-p-dioxin-1,4-diamine
dibenzo-p-dioxin-1,4-diamine (PubChem CID 45028383) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is dibenzo-p-dioxin-1,4-diamine.
Molecular Properties
| Compound Name | dibenzo-p-dioxin-1,4-diamine |
| PubChem CID | 45028383 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | dibenzo-p-dioxin-1,4-diamine |
| SMILES | Nc1ccc(N)c2c1Oc1ccccc1O2 |
| InChI | InChI=1S/C12H10N2O2/c13-7-5-6-8(14)12-11(7)15-9-3-1-2-4-10(9)16-12/h1-6H,13-14H2 |
| InChIKey | QODZEIBXRXTELO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze dibenzo-p-dioxin-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzo-p-dioxin-1,4-diamine?
The IUPAC name of dibenzo-p-dioxin-1,4-diamine (CID 45028383) is dibenzo-p-dioxin-1,4-diamine.
What is the SMILES notation for dibenzo-p-dioxin-1,4-diamine?
The canonical SMILES for dibenzo-p-dioxin-1,4-diamine is Nc1ccc(N)c2c1Oc1ccccc1O2.
What is the InChIKey of dibenzo-p-dioxin-1,4-diamine?
The InChIKey is QODZEIBXRXTELO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c13-7-5-6-8(14)12-11(7)15-9-3-1-2-4-10(9)16-12/h1-6H,13-14H2.
What are the key properties of dibenzo-p-dioxin-1,4-diamine?
dibenzo-p-dioxin-1,4-diamine has a molecular weight of 214.22 g/mol, XLogP of 2.75, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzo-p-dioxin-1,4-diamine is sourced from PubChem (CID 45028383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).