C20H34O3 — CID 45028614
5,10,14,17,17-pentamethyl-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-14-ol (PubChem CID 45028614) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 5,10,14,17,17-pentamethyl-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-14-ol.
| Compound Name | 5,10,14,17,17-pentamethyl-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-14-ol |
|---|---|
| PubChem CID | 45028614 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 5,10,14,17,17-pentamethyl-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-14-ol |
| SMILES | CC1(O)CCC2CC3OC3(C)CCC3OC3(C)CCC1C2(C)C |
| InChI | InChI=1S/C20H34O3/c1-17(2)13-6-9-18(3,21)14(17)7-10-19(4)15(22-19)8-11-20(5)16(12-13)23-20/h13-16,21H,6-12H2,1-5H3 |
| InChIKey | QAKDMKNAZDPAHI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|