About (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid
(4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid (PubChem CID 45028646) has the molecular formula C8H15ClO5P2
and a molecular weight of 288.60 g/mol. Its IUPAC name is (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid.
Molecular Properties
| Compound Name | (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid |
| PubChem CID | 45028646 |
| Molecular Formula | C8H15ClO5P2 |
| Molecular Weight | 288.60 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid |
| SMILES | CCOP1(=O)CC(C)=C(Cl)C(P(=O)(O)O)C1 |
| InChI | InChI=1S/C8H15ClO5P2/c1-3-14-15(10)4-6(2)8(9)7(5-15)16(11,12)13/h7H,3-5H2,1-2H3,(H2,11,12,13) |
| InChIKey | XHNGSQNUGGHBFA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.60 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid?
The IUPAC name of (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid (CID 45028646) is (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid.
What is the SMILES notation for (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid?
The canonical SMILES for (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid is CCOP1(=O)CC(C)=C(Cl)C(P(=O)(O)O)C1.
What is the InChIKey of (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid?
The InChIKey is XHNGSQNUGGHBFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO5P2/c1-3-14-15(10)4-6(2)8(9)7(5-15)16(11,12)13/h7H,3-5H2,1-2H3,(H2,11,12,13).
What are the key properties of (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid?
(4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid has a molecular weight of 288.60 g/mol, XLogP of 2.37, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-1-ethoxy-5-methyl-1-oxo-3,6-dihydro-2H-1λ5-phosphinin-3-yl)phosphonic acid is sourced from PubChem (CID 45028646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).