C28H20ClFN6O2 — CID 45028716
(E)-1-[4-[[4-(4-chloroanilino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 45028716) has the molecular formula C28H20ClFN6O2 and a molecular weight of 526.96 g/mol. Its IUPAC name is (E)-1-[4-[[4-(4-chloroanilino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[[4-(4-chloroanilino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 45028716 |
| Molecular Formula | C28H20ClFN6O2 |
| Molecular Weight | 526.96 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | (E)-1-[4-[[4-(4-chloroanilino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenyl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccco1)c1ccc(Nc2nc(Nc3ccc(F)cc3)nc(Nc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C28H20ClFN6O2/c29-19-5-11-22(12-6-19)32-27-34-26(35-28(36-27)33-23-13-7-20(30)8-14-23)31-21-9-3-18(4-10-21)25(37)16-15-24-2-1-17-38-24/h1-17H,(H3,31,32,33,34,35,36)/b16-15+ |
| InChIKey | WCKRDZCXIZQRIQ-FOCLMDBBSA-N |
| XLogP | 7.38 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.96 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|