C23H20N2O4S — CID 45028862
2-[4-[(E)-(6-methoxy-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenoxy]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 45028862) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-[4-[(E)-(6-methoxy-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenoxy]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[4-[(E)-(6-methoxy-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenoxy]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 45028862 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-[4-[(E)-(6-methoxy-1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenoxy]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccc2c(c1)CC/C(=C\c1ccc(OCC(=O)Nc3nccs3)cc1)C2=O |
| InChI | InChI=1S/C23H20N2O4S/c1-28-19-8-9-20-16(13-19)4-5-17(22(20)27)12-15-2-6-18(7-3-15)29-14-21(26)25-23-24-10-11-30-23/h2-3,6-13H,4-5,14H2,1H3,(H,24,25,26)/b17-12+ |
| InChIKey | RLFDJKAXRSUYAW-SFQUDFHCSA-N |
| XLogP | 4.38 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|