C20H22N2O3 — CID 45028888
3-(3,4,5-trimethoxyphenyl)-3,3a,4,5-tetrahydro-2H-benzo[g]indazole (PubChem CID 45028888) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)-3,3a,4,5-tetrahydro-2H-benzo[g]indazole.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)-3,3a,4,5-tetrahydro-2H-benzo[g]indazole |
|---|---|
| PubChem CID | 45028888 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)-3,3a,4,5-tetrahydro-2H-benzo[g]indazole |
| SMILES | COc1cc(C2NN=C3c4ccccc4CCC32)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N2O3/c1-23-16-10-13(11-17(24-2)20(16)25-3)18-15-9-8-12-6-4-5-7-14(12)19(15)22-21-18/h4-7,10-11,15,18,21H,8-9H2,1-3H3 |
| InChIKey | KDCVPSANUDCDLH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |