C23H38ClNO5 — CID 45028995
[(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] (2S)-2-(dimethylamino)-3-methylbutanoate;hydrochloride (PubChem CID 45028995) has the molecular formula C23H38ClNO5 and a molecular weight of 444.01 g/mol. Its IUPAC name is [(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] (2S)-2-(dimethylamino)-3-methylbutanoate;hydrochloride.
| Compound Name | [(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] (2S)-2-(dimethylamino)-3-methylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 45028995 |
| Molecular Formula | C23H38ClNO5 |
| Molecular Weight | 444.01 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | [(1R,2R,3E,7S,11E,13S,15S)-15-hydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] (2S)-2-(dimethylamino)-3-methylbutanoate;hydrochloride |
| SMILES | CC(C)[C@@H](C(=O)O[C@@H]1/C=C/C(=O)O[C@@H](C)CCC/C=C/[C@@H]2C[C@H](O)C[C@H]21)N(C)C.Cl |
| InChI | InChI=1S/C23H37NO5.ClH/c1-15(2)22(24(4)5)23(27)29-20-11-12-21(26)28-16(3)9-7-6-8-10-17-13-18(25)14-19(17)20;/h8,10-12,15-20,22,25H,6-7,9,13-14H2,1-5H3;1H/b10-8+,12-11+;/t16-,17+,18-,19+,20+,22-;/m0./s1 |
| InChIKey | KGJLAKCYINPKMC-VJZMYGOLSA-N |
| XLogP | 3.52 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.01 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|