C20H36O2 — CID 45029053
(4Z)-2-dodecyl-3,6,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 45029053) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (4Z)-2-dodecyl-3,6,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (4Z)-2-dodecyl-3,6,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 45029053 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (4Z)-2-dodecyl-3,6,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | CCCCCCCCCCCCC1C/C=C\CCCC(=O)O1 |
| InChI | InChI=1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-13-16-19-17-14-11-12-15-18-20(21)22-19/h11,14,19H,2-10,12-13,15-18H2,1H3/b14-11- |
| InChIKey | PINKDURQNFIHAV-KAMYIIQDSA-N |
| XLogP | 6.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|