C24H20O4 — CID 45029088
(3E)-3-[(2,4-dimethoxyphenyl)methylidene]-6-phenylchromen-4-one (PubChem CID 45029088) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is (3E)-3-[(2,4-dimethoxyphenyl)methylidene]-6-phenylchromen-4-one.
| Compound Name | (3E)-3-[(2,4-dimethoxyphenyl)methylidene]-6-phenylchromen-4-one |
|---|---|
| PubChem CID | 45029088 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (3E)-3-[(2,4-dimethoxyphenyl)methylidene]-6-phenylchromen-4-one |
| SMILES | COc1ccc(/C=C2\COc3ccc(-c4ccccc4)cc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C24H20O4/c1-26-20-10-8-18(23(14-20)27-2)12-19-15-28-22-11-9-17(13-21(22)24(19)25)16-6-4-3-5-7-16/h3-14H,15H2,1-2H3/b19-12+ |
| InChIKey | ACZYQFMUDURSLR-XDHOZWIPSA-N |
| XLogP | 5.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|