C18H27NO3 — CID 45029412
[(1R,2R,3E,7S,11E,13S)-7-methyl-5-oxo-6-azabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] acetate (PubChem CID 45029412) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is [(1R,2R,3E,7S,11E,13S)-7-methyl-5-oxo-6-azabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] acetate.
| Compound Name | [(1R,2R,3E,7S,11E,13S)-7-methyl-5-oxo-6-azabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] acetate |
|---|---|
| PubChem CID | 45029412 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [(1R,2R,3E,7S,11E,13S)-7-methyl-5-oxo-6-azabicyclo[11.3.0]hexadeca-3,11-dien-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1/C=C/C(=O)N[C@@H](C)CCC/C=C/[C@@H]2CCC[C@H]21 |
| InChI | InChI=1S/C18H27NO3/c1-13-7-4-3-5-8-15-9-6-10-16(15)17(22-14(2)20)11-12-18(21)19-13/h5,8,11-13,15-17H,3-4,6-7,9-10H2,1-2H3,(H,19,21)/b8-5+,12-11+/t13-,15+,16+,17+/m0/s1 |
| InChIKey | UBGDUCDYMPZMNF-BIAMMYCVSA-N |
| XLogP | 3.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|