C28H38O5S — CID 45029453
[(1S,3R,5R,8E,13S,14R,15R)-5,9,13-trimethyl-17-oxo-18-(phenylsulfanylmethyl)-4,16-dioxatricyclo[13.3.0.03,5]octadec-8-en-14-yl] acetate (PubChem CID 45029453) has the molecular formula C28H38O5S and a molecular weight of 486.67 g/mol. Its IUPAC name is [(1S,3R,5R,8E,13S,14R,15R)-5,9,13-trimethyl-17-oxo-18-(phenylsulfanylmethyl)-4,16-dioxatricyclo[13.3.0.03,5]octadec-8-en-14-yl] acetate.
| Compound Name | [(1S,3R,5R,8E,13S,14R,15R)-5,9,13-trimethyl-17-oxo-18-(phenylsulfanylmethyl)-4,16-dioxatricyclo[13.3.0.03,5]octadec-8-en-14-yl] acetate |
|---|---|
| PubChem CID | 45029453 |
| Molecular Formula | C28H38O5S |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | [(1S,3R,5R,8E,13S,14R,15R)-5,9,13-trimethyl-17-oxo-18-(phenylsulfanylmethyl)-4,16-dioxatricyclo[13.3.0.03,5]octadec-8-en-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2OC(=O)C(CSc3ccccc3)[C@@H]2C[C@H]2O[C@]2(C)CC/C=C(\C)CCC[C@@H]1C |
| InChI | InChI=1S/C28H38O5S/c1-18-10-8-12-19(2)25(31-20(3)29)26-22(16-24-28(4,33-24)15-9-11-18)23(27(30)32-26)17-34-21-13-6-5-7-14-21/h5-7,11,13-14,19,22-26H,8-10,12,15-17H2,1-4H3/b18-11+/t19-,22-,23?,24+,25+,26+,28+/m0/s1 |
| InChIKey | ZZZGBNIZPJLASR-NFNCYGQMSA-N |
| XLogP | 5.96 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|