About 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide
2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide (PubChem CID 45030874) has the molecular formula C11H8ClFN2O2
and a molecular weight of 254.65 g/mol. Its IUPAC name is 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide |
| PubChem CID | 45030874 |
| Molecular Formula | C11H8ClFN2O2 |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide |
| SMILES | O=C(CCl)Nc1oncc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C11H8ClFN2O2/c12-5-10(16)15-11-9(6-14-17-11)7-1-3-8(13)4-2-7/h1-4,6H,5H2,(H,15,16) |
| InChIKey | OPIBTNITOHFBDV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide?
The IUPAC name of 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide (CID 45030874) is 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide.
What is the SMILES notation for 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide?
The canonical SMILES for 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide is O=C(CCl)Nc1oncc1-c1ccc(F)cc1.
What is the InChIKey of 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide?
The InChIKey is OPIBTNITOHFBDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClFN2O2/c12-5-10(16)15-11-9(6-14-17-11)7-1-3-8(13)4-2-7/h1-4,6H,5H2,(H,15,16).
What are the key properties of 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide?
2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide has a molecular weight of 254.65 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[4-(4-fluorophenyl)-1,2-oxazol-5-yl]acetamide is sourced from PubChem (CID 45030874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).