About 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid
2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid (PubChem CID 45032940) has the molecular formula C16H15FN4O6S
and a molecular weight of 410.38 g/mol. Its IUPAC name is 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid.
Molecular Properties
| Compound Name | 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid |
| PubChem CID | 45032940 |
| Molecular Formula | C16H15FN4O6S |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid |
| SMILES | Cn1c(=O)c2nc(S(=O)(=O)CC(=O)O)n(Cc3ccc(F)cc3)c2n(C)c1=O |
| InChI | InChI=1S/C16H15FN4O6S/c1-19-13-12(14(24)20(2)16(19)25)18-15(28(26,27)8-11(22)23)21(13)7-9-3-5-10(17)6-4-9/h3-6H,7-8H2,1-2H3,(H,22,23) |
| InChIKey | DWTJJXGOBNPTGZ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid?
The IUPAC name of 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid (CID 45032940) is 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid.
What is the SMILES notation for 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid?
The canonical SMILES for 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid is Cn1c(=O)c2nc(S(=O)(=O)CC(=O)O)n(Cc3ccc(F)cc3)c2n(C)c1=O.
What is the InChIKey of 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid?
The InChIKey is DWTJJXGOBNPTGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN4O6S/c1-19-13-12(14(24)20(2)16(19)25)18-15(28(26,27)8-11(22)23)21(13)7-9-3-5-10(17)6-4-9/h3-6H,7-8H2,1-2H3,(H,22,23).
What are the key properties of 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid?
2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid has a molecular weight of 410.38 g/mol, XLogP of -0.52, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[9-[(4-fluorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfonylacetic acid is sourced from PubChem (CID 45032940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).