4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid

C8H7N3O2S — CID 45032989

IUPAC4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid
SMILESO=C(O)c1cc(Cn2cncn2)cs1
InChIInChI=1S/C8H7N3O2S/c12-8(13)7-1-6(3-14-7)2-11-5-9-4-10-11/h1,3-5H,2H2,(H,12,13)
InChIKeyBYCMRCNLSHCWIS-UHFFFAOYSA-N
MW209.23 g/mol
LogP1.09
Rot. Bonds3

About 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid

4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid (PubChem CID 45032989) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid.

Molecular Properties

Compound Name4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid
PubChem CID45032989
Molecular FormulaC8H7N3O2S
Molecular Weight209.23 g/mol
Exact Mass209.03
IUPAC Name4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid
SMILESO=C(O)c1cc(Cn2cncn2)cs1
InChIInChI=1S/C8H7N3O2S/c12-8(13)7-1-6(3-14-7)2-11-5-9-4-10-11/h1,3-5H,2H2,(H,12,13)
InChIKeyBYCMRCNLSHCWIS-UHFFFAOYSA-N
XLogP1.09
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.23
LogP ≤ 51.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid?
The IUPAC name of 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid (CID 45032989) is 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid.
What is the SMILES notation for 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid?
The canonical SMILES for 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid is O=C(O)c1cc(Cn2cncn2)cs1.
What is the InChIKey of 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid?
The InChIKey is BYCMRCNLSHCWIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2S/c12-8(13)7-1-6(3-14-7)2-11-5-9-4-10-11/h1,3-5H,2H2,(H,12,13).
What are the key properties of 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid?
4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid has a molecular weight of 209.23 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,4-triazol-1-ylmethyl)thiophene-2-carboxylic acid is sourced from PubChem (CID 45032989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).