C8H10N4O3 — CID 45033197
3,7-dimethyl-2,6-dioxo-4,5-dihydropurine-8-carbaldehyde (PubChem CID 45033197) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is 3,7-dimethyl-2,6-dioxo-4,5-dihydropurine-8-carbaldehyde.
| Compound Name | 3,7-dimethyl-2,6-dioxo-4,5-dihydropurine-8-carbaldehyde |
|---|---|
| PubChem CID | 45033197 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3,7-dimethyl-2,6-dioxo-4,5-dihydropurine-8-carbaldehyde |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(C=O)N2C |
| InChI | InChI=1S/C8H10N4O3/c1-11-4(3-13)9-6-5(11)7(14)10-8(15)12(6)2/h3,5-6H,1-2H3,(H,10,14,15) |
| InChIKey | QAXYFPSJYIQULR-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|