About 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione
2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione (PubChem CID 45033462) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione.
Molecular Properties
| Compound Name | 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione |
| PubChem CID | 45033462 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione |
| SMILES | CC1CC(O)C2C(=O)C(=O)C2C1 |
| InChI | InChI=1S/C9H12O3/c1-4-2-5-7(6(10)3-4)9(12)8(5)11/h4-7,10H,2-3H2,1H3 |
| InChIKey | MDEPHMYJEZAAPG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione?
The IUPAC name of 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione (CID 45033462) is 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione.
What is the SMILES notation for 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione?
The canonical SMILES for 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione is CC1CC(O)C2C(=O)C(=O)C2C1.
What is the InChIKey of 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione?
The InChIKey is MDEPHMYJEZAAPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-4-2-5-7(6(10)3-4)9(12)8(5)11/h4-7,10H,2-3H2,1H3.
What are the key properties of 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione?
2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione has a molecular weight of 168.19 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-methylbicyclo[4.2.0]octane-7,8-dione is sourced from PubChem (CID 45033462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).