C21H21N3O4 — CID 45034728
phenyl 4-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]-4-oxobutanoate (PubChem CID 45034728) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is phenyl 4-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]-4-oxobutanoate.
| Compound Name | phenyl 4-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 45034728 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | phenyl 4-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)anilino]-4-oxobutanoate |
| SMILES | CC1CC(=O)NN=C1c1ccc(NC(=O)CCC(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-14-13-19(26)23-24-21(14)15-7-9-16(10-8-15)22-18(25)11-12-20(27)28-17-5-3-2-4-6-17/h2-10,14H,11-13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | HAKNGHSTIAOHBC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|