About N,4-diphenyl-1,3-dithiol-2-imine
N,4-diphenyl-1,3-dithiol-2-imine (PubChem CID 45034962) has the molecular formula C15H11NS2
and a molecular weight of 269.39 g/mol. Its IUPAC name is N,4-diphenyl-1,3-dithiol-2-imine.
Molecular Properties
| Compound Name | N,4-diphenyl-1,3-dithiol-2-imine |
| PubChem CID | 45034962 |
| Molecular Formula | C15H11NS2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | N,4-diphenyl-1,3-dithiol-2-imine |
| SMILES | c1ccc(/N=c2\scc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C15H11NS2/c1-3-7-12(8-4-1)14-11-17-15(18-14)16-13-9-5-2-6-10-13/h1-11H/b16-15+ |
| InChIKey | GQIVTELJIVDSOB-FOCLMDBBSA-N |
| XLogP | 4.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,4-diphenyl-1,3-dithiol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-diphenyl-1,3-dithiol-2-imine?
The IUPAC name of N,4-diphenyl-1,3-dithiol-2-imine (CID 45034962) is N,4-diphenyl-1,3-dithiol-2-imine.
What is the SMILES notation for N,4-diphenyl-1,3-dithiol-2-imine?
The canonical SMILES for N,4-diphenyl-1,3-dithiol-2-imine is c1ccc(/N=c2\scc(-c3ccccc3)s2)cc1.
What is the InChIKey of N,4-diphenyl-1,3-dithiol-2-imine?
The InChIKey is GQIVTELJIVDSOB-FOCLMDBBSA-N. The full InChI is InChI=1S/C15H11NS2/c1-3-7-12(8-4-1)14-11-17-15(18-14)16-13-9-5-2-6-10-13/h1-11H/b16-15+.
What are the key properties of N,4-diphenyl-1,3-dithiol-2-imine?
N,4-diphenyl-1,3-dithiol-2-imine has a molecular weight of 269.39 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-diphenyl-1,3-dithiol-2-imine is sourced from PubChem (CID 45034962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).