C21H27NO3S — CID 45035102
(3E)-1,7,7-trimethyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one (PubChem CID 45035102) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is (3E)-1,7,7-trimethyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (3E)-1,7,7-trimethyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 45035102 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (3E)-1,7,7-trimethyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(/C(=C\c3ccc(S(=O)(=O)N4CCCC4)cc3)C1=O)C2(C)C |
| InChI | InChI=1S/C21H27NO3S/c1-20(2)18-10-11-21(20,3)19(23)17(18)14-15-6-8-16(9-7-15)26(24,25)22-12-4-5-13-22/h6-9,14,18H,4-5,10-13H2,1-3H3/b17-14+ |
| InChIKey | ZEWUYNOYYXDWTO-SAPNQHFASA-N |
| XLogP | 3.88 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|