C15H15NO2 — CID 45035716
spiro[chromeno[3,4-d][1,2]oxazole-4,1'-cyclohexane] (PubChem CID 45035716) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is spiro[chromeno[3,4-d][1,2]oxazole-4,1'-cyclohexane].
| Compound Name | spiro[chromeno[3,4-d][1,2]oxazole-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 45035716 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | spiro[chromeno[3,4-d][1,2]oxazole-4,1'-cyclohexane] |
| SMILES | c1ccc2c(c1)OC1(CCCCC1)c1cnoc1-2 |
| InChI | InChI=1S/C15H15NO2/c1-4-8-15(9-5-1)12-10-16-18-14(12)11-6-2-3-7-13(11)17-15/h2-3,6-7,10H,1,4-5,8-9H2 |
| InChIKey | PMQMQINODMWSTQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |