C15H12I2N2O2S — CID 4503670
2-[(2,5-diiodobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 4503670) has the molecular formula C15H12I2N2O2S and a molecular weight of 538.15 g/mol. Its IUPAC name is 2-[(2,5-diiodobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(2,5-diiodobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4503670 |
| Molecular Formula | C15H12I2N2O2S |
| Molecular Weight | 538.15 g/mol |
| Exact Mass | 537.87 |
| IUPAC Name | 2-[(2,5-diiodobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2cc(I)ccc2I)sc2c1CCC2 |
| InChI | InChI=1S/C15H12I2N2O2S/c16-7-4-5-10(17)9(6-7)14(21)19-15-12(13(18)20)8-2-1-3-11(8)22-15/h4-6H,1-3H2,(H2,18,20)(H,19,21) |
| InChIKey | ZYLQDDOZSZEWPN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.15 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|