About (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile
(Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile (PubChem CID 45036885) has the molecular formula C12H10Cl2N2O
and a molecular weight of 269.13 g/mol. Its IUPAC name is (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile |
| PubChem CID | 45036885 |
| Molecular Formula | C12H10Cl2N2O |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile |
| SMILES | CN(C)/C=C(/C#N)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl2N2O/c1-16(2)7-8(6-15)12(17)10-4-3-9(13)5-11(10)14/h3-5,7H,1-2H3/b8-7- |
| InChIKey | YZCIMQOXZWNHSQ-FPLPWBNLSA-N |
| XLogP | 3.15 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile?
The IUPAC name of (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile (CID 45036885) is (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile.
What is the SMILES notation for (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile?
The canonical SMILES for (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile is CN(C)/C=C(/C#N)C(=O)c1ccc(Cl)cc1Cl.
What is the InChIKey of (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile?
The InChIKey is YZCIMQOXZWNHSQ-FPLPWBNLSA-N. The full InChI is InChI=1S/C12H10Cl2N2O/c1-16(2)7-8(6-15)12(17)10-4-3-9(13)5-11(10)14/h3-5,7H,1-2H3/b8-7-.
What are the key properties of (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile?
(Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile has a molecular weight of 269.13 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2,4-dichlorobenzoyl)-3-(dimethylamino)prop-2-enenitrile is sourced from PubChem (CID 45036885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).