About 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione
5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione (PubChem CID 45036958) has the molecular formula C8H13Cl2N3O2
and a molecular weight of 254.12 g/mol. Its IUPAC name is 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione |
| PubChem CID | 45036958 |
| Molecular Formula | C8H13Cl2N3O2 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione |
| SMILES | O=C1NCC(N(CCCl)CCCl)C(=O)N1 |
| InChI | InChI=1S/C8H13Cl2N3O2/c9-1-3-13(4-2-10)6-5-11-8(15)12-7(6)14/h6H,1-5H2,(H2,11,12,14,15) |
| InChIKey | QSSVNPRNZZOFED-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione?
The IUPAC name of 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione (CID 45036958) is 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione.
What is the SMILES notation for 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione?
The canonical SMILES for 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione is O=C1NCC(N(CCCl)CCCl)C(=O)N1.
What is the InChIKey of 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione?
The InChIKey is QSSVNPRNZZOFED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Cl2N3O2/c9-1-3-13(4-2-10)6-5-11-8(15)12-7(6)14/h6H,1-5H2,(H2,11,12,14,15).
What are the key properties of 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione?
5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione has a molecular weight of 254.12 g/mol, XLogP of -0.03, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bis(2-chloroethyl)amino]-1,3-diazinane-2,4-dione is sourced from PubChem (CID 45036958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).