C25H22N4O2S — CID 45037511
6-(2-ethoxynaphthalen-1-yl)-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 45037511) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is 6-(2-ethoxynaphthalen-1-yl)-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-(2-ethoxynaphthalen-1-yl)-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 45037511 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 6-(2-ethoxynaphthalen-1-yl)-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | C=CCSc1nnc2c(n1)OC(c1c(OCC)ccc3ccccc13)Nc1ccccc1-2 |
| InChI | InChI=1S/C25H22N4O2S/c1-3-15-32-25-27-24-22(28-29-25)18-11-7-8-12-19(18)26-23(31-24)21-17-10-6-5-9-16(17)13-14-20(21)30-4-2/h3,5-14,23,26H,1,4,15H2,2H3 |
| InChIKey | GRTXLOYKXHOCPH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|